Hexapeptid
val-val-val-val-val-val
C30H56N6O7

Drehung
Stereo
Bindungen
Atome
Amid-Ebenen
HUWagner + JBek
LMU München
7.7.2013
Zurück zur Liste
SMILES:
CC(C)[C@H]([NH3+])C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)
N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C([O-])=O
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p) cosmo(water)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen