Triarylphoshinoxid-W6
2-{bis[2,6-bis(difluoromethyl)phenyl]-
phosphoroso}-1,3-bis(difluoromethyl)-
benzene

C24H15F12OP

Drehung:
Stereo:
Bindungen:
Atome:

Eav Wille

HUWagner + JBek
LMU München
20.07.2013

Zurück zur Liste
SMILES: FC(F)C1=CC=CC(C(F)F)=C1P(=O)(C1=C(C=CC=C1C(F)F)C(F)F)C1=C(C=CC=C1C(F)F)C(F)F
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen