trans-1-Chlor-4-methyl-cyclohexan
Methyl equatorial - Chlor axial
stabiler

trans-1-Chlor-4-methyl-cyclohexan
Methyl axial - Chlor equatorial
weniger stabil

C7H13Cl




1-Chlor-4-methyl-cyclohexane


2 Konformere

HUWagner + JBek
LMU München
11.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: C[C@H]1CC[C@H](Cl)CC1.C[C@H]1CC[C@H](Cl)CC1
Geometrie: Quantenchemisch MP2/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen