(R)-Thalidomid
(R)-Contergan

(S)-Thalidomid
(S)-Contergan

C13H10N2O4

Thalidomid
Contergan


HUWagner + JBek
LMU München
15.07.2013

Zurück zur Liste
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: O=C1N([C@@H]2CCC(=O)NC2=O)C(=O)C2=C1C=CC=C2.O=C1N([C@H]2CCC(=O)NC2=O)C(=O)C2=C1C=CC=C2
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen