Tetrodotoxin  Nervengift

C11H18N3O8


Drehung:
Stereo:
Bindungen:
Atome:


HUWagner + JBek
LMU München
16.07.2013

Zurück zur Liste
SMILES: OC[C@@]1(O)[C@H]2O[C@@]3(O)O[C@@H]1[C@@H]1[C@@H]
(O)NC(=[NH2+])N[C@]1([C@@H]2O)[C@@H]3O
Geometrie: Kristallstruktur X-Ray H ergänzt
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen