(2S)-2-Hydroxy-tetrahydrofuran
(2S)-Oxolan-2-ol

(2R)-2-Hydroxy-tetrahydrofuran
(2R)-Oxolan-2-ol

C4H8O2

2-Hydroxy-
tetrahydrofuran
Oxolan-2-ol

Enantiomere


HUWagner + JBek
LMU München
17.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: O[C@@H]1CCCO1.O[C@H]1CCCO1
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen