Bis(rac-tartrato-κ2O2,O3)cuprat(6−)
Tartrat-Kupfer-Komplex
bei hohem pH-Wert

C8H4CuO12

Ladungen nicht dargestellt

Drehung
Stereo
Bindungen
Atome
Peter Klüfers

HUWagner + JBek
LMU München
17.06.2013

 

Zurück zur Liste
 
SMILES: [O-]C(=O)[C@H]1O[Cu]2(O[C@@H]1C([O-])=O)O[C@H]([C@@H](O2)C([O-])=O)C([O-])=O
Geometrie: Kristallstruktur X-Ray
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen