Sucrose Sarcosine

C15H31NO14

Drehung:
Stereo:
Bindungen:
Atome:



HUWagner + JBek
LMU München
17.07.2013

Zurück zur Liste
SMILES: C[NH2+]CC([O-])=O
OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O
Geometrie: Kristallstruktur X-Ray
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen