trans-Stilben

cis-Stilben

C14H12




(E)/(Z)-Stilben



HUWagner + JBek
LMU München
30.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: C(=C/C1=CC=CC=C1)\C1=CC=CC=C1.C(=C\C1=CC=CC=C1)\C1=CC=CC=C1
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen