(-)-Spartein

Alkaloid

C15H26N2

Drehung:
Stereo:
Bindungen:
Atome:



HUWagner + JBek
LMU München
17.07.2013

Zurück zur Liste
SMILES: C1CCN2C[C@@H]3C[C@@H](CN4CCCC[C@H]34)[C@@H]2C11
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen