Serotonin

C10H12N2O

Drehung
Stereo
Bindungen
Atome
 

HUWagner + JBek
LMU München
08.06.2013


Zurück zur Liste
 
SMILES: NCC[c]1=c[nH]c2ccc(O)cc12
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen