Aminosäuren-Nachweis
Ruhemanns Blau

C18H8NO4(-)

Ladungen
nicht dargestellt

Drehung
Stereo
Bindungen
Atome


HUWagner + JBek
LMU München
03.07.2013

Zurück zur Liste
SMILES: [O-]C1=C(N=C2C(=O)C3=C(C=CC=C3)C2=O)C(=O)C2=C1C=CC=C2
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen