(R)-(+)-Limonen
D-(+)-Limonen
Geruch nach Orangen u Zitronen
(S)-(-)-Limonen
L-(-)-Limonen
Geruch nach Terpentin

C10H16


(R)/(S)-Limonen





 
 
 


HUWagner + JBek
LMU München
17.11.2014
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CC(=C)[C@@H]1CCC(C)=CC1.CC(=C)[C@H]1CCC(C)=CC1
Geometrie: Quantenchemisch MP2/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen