(R)-(-)-Carvon
L-(-)-Carvon
Geruch nach Minze
(S)-(+)-Carvon
D-(+)-Carvon
Geruch nach Kümmel

C10H16


Carvon





 
 
 


HUWagner + JBek
LMU München
28.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CC(=C)[C@@H]1CC=C(C)C(=O)C1.CC(=C)[C@H]1CC=C(C)C(=O)C1
Geometrie: Quantenchemisch MP2/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen