(1S)-2-Brom-1-phenyl-ethyl-acetat

(1R)-2-Brom-1-phenyl-ethyl-acetat

C10H11BrO2

2-Brom-1-phenyl-ethyl-
acetat



HUWagner + JBek
LMU München
15.07.2013

Zurück zur Liste
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CC(=O)O[C@H](CBr)c1ccccc1.CC(=O)O[C@@H](CBr)c1ccccc1
Geometrie: Quantenchemisch MP2/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen