(1S)-1,2-Dibrom-1-phenyl-ethan

(1R)-1,2-Dibrom-1-phenyl-ethan

C8H8Br2


1,2-Dibrom-1-phenyl-ethan






HUWagner + JBek
LMU München
26.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: BrC[C@@H](Br)C1=CC=CC=C1.BrC[C@H](Br)C1=CC=CC=C1
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen