alpha-D-Ribo-furanose

beta-D-Ribo-furanose
      C5H10O5


Drehung   Stereo
   
Bindungen   Atome
   
 

Drehung   Stereo
   
Bindungen   Atome
   
  D-Ribo-
furanosen




HUWagner + JBek
LMU München
26.6.2013

Zurück zur Liste




Geometrie:
Molekülmechanik
Dreiding Kraftfeld
             
 
alpha-D-Ribo-pyranose
beta-D-Ribo-pyranose
       


Drehung   Stereo
   
Bindungen   Atome
   
 

Drehung   Stereo
   
Bindungen   Atome
   
  D-Ribo- pyranosen



HUWagner + JBek
LMU München
26.6.2013

Zurück zur Liste




Geometrie:
Molekülmechanik
Dreiding Kraftfeld

      SMILES Ribofuranosen: OC[C@H]1O[C@H](O)[C@H](O)[C@@H]1O.OC[C@H]1O[C@@H](O)[C@H](O)[C@@H]1O

      SMILES Ribopyranosen: O[C@@H]1CO[C@H](O)[C@H](O)[C@@H]1O.O[C@@H]1CO[C@@H](O)[C@H](O)[C@@H]1O

      Linke Maustaste = Molekül bewegen
      Mittlere Maustaste = Molekül zoomen
      Rechte Maustaste = Jmol Menu