Retinol

C20H30O

Drehung
Stereo
Bindungen
Atome


HUWagner + JBek
LMU München
02.07.2013

Zurück zur Liste
SMILES: CC(\C=C\C=C(C)\C=C\C1=C(C)CCCC1(C)C)=C/CO
Geometrie: Semiempirisch AM1
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen