trans-Resveratrol

cis-Resveratrol

C14H12O3





cis/trans-Resveratrol







HUWagner + JBek
LMU München
28.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: OC1=CC=C(\C=C\C2=CC(O)=CC(O)=C2)C=C1.OC1=CC=C(\C=C/C2=CC(O)=CC(O)=C2)C=C1
Geometrie: 2 Konfigurationsisomere Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen