6,6'-Dibromindigo: Purpur

C16H8Br2N2O2


Drehung:
Stereo:
Bindungen:
Atome:

 

HUWagner + JBek
LMU München
20.01.2014

Zurück zur Liste
SMILES: BrC1=CC2=C(C=C1)C(=O)\C(N2)=C1/NC2=C(C=CC(Br)=C2)C1=O
Geometrie: Kristallstruktur
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen