Phosphoniovinamidium 166

C25H29N2P

Ladungen nicht angezeigt

Drehung:
Stereo:
Bindungen:
Atome:

Eckard Kujath

HUWagner + JBek
LMU München
21.07.2013

Zurück zur Liste
SMILES: CN(C)c:c(:cN(C)C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1
Geometrie: Quantenchemisch DFT RB3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen