(2R)-Pentan-2-ol

(2S)-Pentan-2-ol

C5H12O


Pentan-2-ole





HUWagner + JBek
LMU München
04.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CCC[C@@H](C)O.CCC[C@H](C)O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen