Pelargonidin

C15H11O5

Rotwein-Anthocyanin


Drehung:
Stereo:
Bindungen:
Atome:

Claudia u Herbert Bek

HUWagner u JBek
LMU München
20.12.2013

Zurück zur Liste
SMILES: OC1=CC=C(C=C1)C1=[O+]C2=CC(O)=CC(O)=C2C=C1O
Geometrie: Quantenchemisch DFT/PBE
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen