p-Toluolsulfonsäure-
n-butylester

C11H16O3S


Drehung
Stereo
Bindungen
Atome
 

HUWagner + JBek
LMU München
04.06.2013

Zurück zur Liste
 
SMILES: CCCCO[S++]([O-])([O-])c1ccc(C)cc1
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen