Oxalacetat
Keto-Tautomer

Oxalacetat
Enol-Tautomer

C4H2O5

Oxalacetat
Keto/Enol-
Tautomerie

Ladungen nicht
dargestellt

HUWagner + JBek
LMU München
10.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: [O-]C(=O)CC(=O)C([O-])=O.O\C([O-])=C/C(=O)C([O-])=O
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p) cosmo(water)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen