ortho-Nitrotoluol

meta-Nitrotoluol

para-Nitrotoluol

C7H7NO2











Nitrotoluol-
Isomere


Formalladungen
nicht angezeigt

HUWagner + JBek
LMU München
27.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CC1=CC=CC=C1[N+]([O-])=O.CC1=CC=CC(=C1)[N+]([O-])=O.CC1=CC=C(C=C1)[N+]([O-])=O
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen