Noradrenalinium

C8H12NO3
Ladung nicht dargestellt

Drehung:
Stereo:
Bindungen:
Atome:

 

HUWagner + JBek
LMU München
1.12.2013

Zurück zur Liste
SMILES: [NH3+]C[C@H](O)C1=CC(O)=C(O)C=C1
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen