Mycomycin

C13H10O2


Drehung
Stereo
Bindungen
Atome

HUWagner + JBek
LMU München
16.07.2013

Zurück zur Liste
 
SMILES: OC(=O)C\C=C\C=C\C=C=CC#CC#C
Geometrie: Semiempirisch AM1
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen