Münchnon

C16H13NO2


Drehung:
Stereo:
Bindungen:
Atome:

R. Huisgen

HUWagner + JBek
LMU München
13.06.2012

Zurück zur Liste
SMILES: C[N+]1=C(OC([O-])=C1C1=CC=CC=C1)C1=CC=CC=C1
Geometrie: Molekül Mechanik Dreiding Kraftfeld
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen