(S)-Mandelsäure

(R)-Mandelsäure

C8H8O3

Mandelsäure




HUWagner + JBek
LMU München
15.03.2014

Zurück zur Liste
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: O[C@H](C(O)=O)C1=CC=CC=C1.O[C@@H](C(O)=O)C1=CC=CC=C1
Geometrie: Quantenchemisch LDA/Def2-SVP
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen