Malonsäure

Malonsäure H-Brücke

C3H4O4




Malonsäure

2 Konformationen



Sabine Auras

HUWagner + JBek
LMU München
30.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: C[C@@H](O)C(O)=O.C[C@H](O)C(O)=O
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p) cosmo(water)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen