Linolsäure
(9Z,12Z)-Octadeca-9,12-diensäure

C18H32O2

Drehung
Stereo
Bindungen
Atome
 

HUWagner + JBek
LMU München
28.06.2012

Zurück zur Liste
SMILES: CCCCC\C=C/C\C=C/CCCCCCCC(O)=O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen