Linolensäure
(9Z,12Z,15Z)-Octadeca-9,12,15-triensäure

C18H30O2

Drehung
Stereo
Bindungen
Atome
 

HUWagner + JBek
LMU München
28.06.2012

Zurück zur Liste
SMILES: CC\C=C/C\C=C/C\C=C/CCCCCCCC(O)=O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen