L-Prolin
(S)-Prolin

D-Prolin
(R)-Prolin

C5H9NO2

Proline
Zwitterionen
Betaine



Sabine Auras
HUWagner + JBek
LMU München
04.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: OC(=O)[C@@H]1CCCN1.OC(=O)[C@H]1CCCN1
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen