L-(+)-Lysin
(R)-(+)-Lysin

D-(-)-Lysin
(S)-(-)-Lysin

C6H15N2O2S


Lysine
Kationen




Sabine Auras
HUWagner + JBek
LMU München
02.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: NCCCC[C@H](N)C(O)=O.NCCCC[C@@H](N)C(O)=O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen