L-Leucin
(S)-Leucin

D-Leucin
(R)-Leucin

C6H13NO2


Leucine
Zwitterionen
Betaine




Sabine Auras
HUWagner + JBek
LMU München
02.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CC(C)C[C@H]([NH3+])C([O-])=O.CC(C)C[C@@H]([NH3+])C([O-])=O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen