L-(+)-Milchsäure
(S)-(+)-Milchsäure

D-(-)-Milchsäure
(R)-(-)-Milchsäure

C3H6O3


Milchsäure

2-Hydroxy-
propansäure




HUWagner + JBek
LMU München
05.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: C[C@@H](O)C(O)=O.C[C@H](O)C(O)=O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen