L-Isoleucin
(S)-Isoleucin

D-Isoleucin
(R)-Isoleucin

C6H13NO2


Isoleucine
Zwitterionen
Betaine





HUWagner + JBek
LMU München
02.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CC(C)C[C@H]([NH3+])C([O-])=O.CC(C)C[C@@H]([NH3+])C([O-])=O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen