L-Glycerin-aldehyd
S-Glycerin-aldehyd

Konfigurations-Isomere

D-Glycerin-aldehyd
R-Glycerin-aldehyd

C3H6O3


Aldotriosen


Sabine Auras
HUWagner + JBek
LMU München
25.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: OC[C@H](O)C=O.OC[C@@H](O)C=O
Geometrie: Quantenchmisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen