L-(+)-Glutamat
(R)-(+)-Glutamat

D-(-)-Glutamat
(S)-(-)-Glutamat

C6H15N2O2S


Glutamate
Anionen





HUWagner + JBek
LMU München
02.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: [NH3+][C@@H](CCC([O-])=O)C([O-])=O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen