L-(+)-Cystein
(R)-(+)-Cystein
Zwitterion   Betain

D-(-)-Cystein
(S)-(-)-Cystein
Zwitterion   Betain

C3H7NO2S


Cysteine




Sabine Auras
HUWagner + JBek
LMU München
02.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: [NH3+][C@H](CS)C([O-])=O.[NH3+][C@@H](CS)C([O-])=O
Geometrie: Quantenchemeisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen