L-(+)-Alanin
(S)-(+)-Alanin
Zwitterion   Betain

D-(-)-Alanin
(R)-(-)-Alanin
Zwitterion   Betain

C3H7NO2


Alanin




Sabine Auras
HUWagner + JBek
LMU München
06.11.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: C[C@H]([NH3+])C([O-])=O.C[C@@H]([NH3+])C([O-])=O
Geometrie: Kristallstruktur X-Ray
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen