L-Äpfelsäure
(S)-Äpfelsäure

D-Äpfelsäure
(R)-Äpfelsäure

C4H6O5


Äpfelsäuren






HUWagner + JBek
LMU München
05.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: O[C@@H](CC(O)=O)C(O)=O.O[C@H](CC(O)=O)C(O)=O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen