18-Krone-6-ether Kalium

C12H24KO6


Drehung
Stereo
Bindungen
Atome
 

HUWagner + JBek
LMU München
04.06.2013


Zurück zur Liste
 
SMILES: C1C[O]2CC[O]3CC[O]4CC[O]5CC[O]6CC[O]1[K]23456
Geometrie: Kristallstruktur X-Ray
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen