(11S)-10-(4-fluorophenoxycarbonyl)-
11-(propan-2-yl)-8-thia-1-lambda{5},10-
diazatricyclo[7.4.0.0{2,7}]trideca-
1(9),2,4,6-tetraen-1-ylium

Drehung
Stereo
Bindungen
Atome
H. Mayr

HUWagner + JBek
LMU München
08.06.2013


Zurück zur Liste
 
SMILES: CC(C)[C@@H]1CC[n+]2c(sc3ccccc23)N1C(=O)Oc1ccc(F)cc1
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen