trans-Isoeugenol

cis-Isoeugenol

C10H12O2







Isoeugenol










HUWagner u JBek
LMU München
20.1.2014





Zurück zur Liste
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: COC1=C(O)C=CC(\C=C\C)=C1/COC1=C(O)C=CC(\C=C/C)=C1
Geometrie: DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen