(2S)-Isobutyl-benzen

(2R)-Isobutyl-benzen

C10H14

Isobutyl-benzen







HUWagner + JBek
LMU München
25.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CC[C@H](C)c1ccccc1.CC[C@@H](C)c1ccccc1
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen