Hexachlorophen


C13H6Cl6O2

Drehung
Stereo
Bindungen
Atome


HUWagner + JBek
LMU München
27.05.2013

 

Zurück zur Liste
 
SMILES: OC1=C(CC2=C(Cl)C(Cl)=CC(Cl)=C2O)C(Cl)=C(Cl)C=C1Cl
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen