alpha-Helix
N-gly-gly-gly-gly-gly-
gly-gly-gly-gly-gly-CO

C20H32N10O11

Blick entlang
Drehung
Stereo
Bindungen
Atome
HUWagner + JBek
LMU München
09.07.2013

Zurück zur Liste
SMILES: [NH3+]CC(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)NCC([O-])=O
Geometrie: Vereinfachtes Modell gebaut aus einer Kristallstruktur
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen