(R)-1-Chlor-1-brom-2,2,2-trifluorethan

(R)-Halothan

(S)-1-Chlor-1-brom-2,2,2-trifluorethan

(S)-Halothan

 

C2HBrClF3


(R)/(S)-Halothane







HUWagner + JBek
LMU München
01.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: [H][C@@](Cl)(Br)C(F)(F)F.[H][C@](Cl)(Br)C(F)(F)F
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen